2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid

C10H6F2N2O2S — CID 80570903

IUPAC2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(Nc2cc(F)ccc2F)s1
InChIInChI=1S/C10H6F2N2O2S/c11-5-1-2-6(12)7(3-5)14-10-13-4-8(17-10)9(15)16/h1-4H,(H,13,14)(H,15,16)
InChIKeyQXOGEQBEGXYGME-UHFFFAOYSA-N
MW256.23 g/mol
LogP2.86
Rot. Bonds3

About 2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid

2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid (PubChem CID 80570903) has the molecular formula C10H6F2N2O2S and a molecular weight of 256.23 g/mol. Its IUPAC name is 2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid
PubChem CID80570903
Molecular FormulaC10H6F2N2O2S
Molecular Weight256.23 g/mol
Exact Mass256.01
IUPAC Name2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(Nc2cc(F)ccc2F)s1
InChIInChI=1S/C10H6F2N2O2S/c11-5-1-2-6(12)7(3-5)14-10-13-4-8(17-10)9(15)16/h1-4H,(H,13,14)(H,15,16)
InChIKeyQXOGEQBEGXYGME-UHFFFAOYSA-N
XLogP2.86
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.23
LogP ≤ 52.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid (CID 80570903) is 2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(Nc2cc(F)ccc2F)s1.
What is the InChIKey of 2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid?
The InChIKey is QXOGEQBEGXYGME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F2N2O2S/c11-5-1-2-6(12)7(3-5)14-10-13-4-8(17-10)9(15)16/h1-4H,(H,13,14)(H,15,16).
What are the key properties of 2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid?
2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid has a molecular weight of 256.23 g/mol, XLogP of 2.86, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-difluoroanilino)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 80570903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).