About 2-[(2,2-dimethylcyclopropyl)amino]-1,3-thiazole-5-carboxylic acid
2-[(2,2-dimethylcyclopropyl)amino]-1,3-thiazole-5-carboxylic acid (PubChem CID 80570956) has the molecular formula C9H12N2O2S
and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-[(2,2-dimethylcyclopropyl)amino]-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(2,2-dimethylcyclopropyl)amino]-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 80570956 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 2-[(2,2-dimethylcyclopropyl)amino]-1,3-thiazole-5-carboxylic acid |
| SMILES | CC1(C)CC1Nc1ncc(C(=O)O)s1 |
| InChI | InChI=1S/C9H12N2O2S/c1-9(2)3-6(9)11-8-10-4-5(14-8)7(12)13/h4,6H,3H2,1-2H3,(H,10,11)(H,12,13) |
| InChIKey | XPNFWFDQNTZGSL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2,2-dimethylcyclopropyl)amino]-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,2-dimethylcyclopropyl)amino]-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-[(2,2-dimethylcyclopropyl)amino]-1,3-thiazole-5-carboxylic acid (CID 80570956) is 2-[(2,2-dimethylcyclopropyl)amino]-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-[(2,2-dimethylcyclopropyl)amino]-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-[(2,2-dimethylcyclopropyl)amino]-1,3-thiazole-5-carboxylic acid is CC1(C)CC1Nc1ncc(C(=O)O)s1.
What is the InChIKey of 2-[(2,2-dimethylcyclopropyl)amino]-1,3-thiazole-5-carboxylic acid?
The InChIKey is XPNFWFDQNTZGSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S/c1-9(2)3-6(9)11-8-10-4-5(14-8)7(12)13/h4,6H,3H2,1-2H3,(H,10,11)(H,12,13).
What are the key properties of 2-[(2,2-dimethylcyclopropyl)amino]-1,3-thiazole-5-carboxylic acid?
2-[(2,2-dimethylcyclopropyl)amino]-1,3-thiazole-5-carboxylic acid has a molecular weight of 212.27 g/mol, XLogP of 2.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-dimethylcyclopropyl)amino]-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 80570956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).