2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid

C12H12N2O2S — CID 80571652

IUPAC2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid
SMILESCc1cc(C)cc(Nc2ncc(C(=O)O)s2)c1
InChIInChI=1S/C12H12N2O2S/c1-7-3-8(2)5-9(4-7)14-12-13-6-10(17-12)11(15)16/h3-6H,1-2H3,(H,13,14)(H,15,16)
InChIKeyHYOHBAYNLFEORN-UHFFFAOYSA-N
MW248.31 g/mol
LogP3.20
Rot. Bonds3

About 2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid

2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid (PubChem CID 80571652) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid
PubChem CID80571652
Molecular FormulaC12H12N2O2S
Molecular Weight248.31 g/mol
Exact Mass248.06
IUPAC Name2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid
SMILESCc1cc(C)cc(Nc2ncc(C(=O)O)s2)c1
InChIInChI=1S/C12H12N2O2S/c1-7-3-8(2)5-9(4-7)14-12-13-6-10(17-12)11(15)16/h3-6H,1-2H3,(H,13,14)(H,15,16)
InChIKeyHYOHBAYNLFEORN-UHFFFAOYSA-N
XLogP3.20
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.31
LogP ≤ 53.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid (CID 80571652) is 2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid is Cc1cc(C)cc(Nc2ncc(C(=O)O)s2)c1.
What is the InChIKey of 2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid?
The InChIKey is HYOHBAYNLFEORN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2S/c1-7-3-8(2)5-9(4-7)14-12-13-6-10(17-12)11(15)16/h3-6H,1-2H3,(H,13,14)(H,15,16).
What are the key properties of 2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid?
2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid has a molecular weight of 248.31 g/mol, XLogP of 3.20, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethylanilino)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 80571652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).