About methyl 2-[(1-methylpyrazol-3-yl)amino]-1,3-thiazole-5-carboxylate
methyl 2-[(1-methylpyrazol-3-yl)amino]-1,3-thiazole-5-carboxylate (PubChem CID 80571956) has the molecular formula C9H10N4O2S
and a molecular weight of 238.27 g/mol. Its IUPAC name is methyl 2-[(1-methylpyrazol-3-yl)amino]-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[(1-methylpyrazol-3-yl)amino]-1,3-thiazole-5-carboxylate |
| PubChem CID | 80571956 |
| Molecular Formula | C9H10N4O2S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | methyl 2-[(1-methylpyrazol-3-yl)amino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(Nc2ccn(C)n2)s1 |
| InChI | InChI=1S/C9H10N4O2S/c1-13-4-3-7(12-13)11-9-10-5-6(16-9)8(14)15-2/h3-5H,1-2H3,(H,10,11,12) |
| InChIKey | DYFQWEKQKJCPLV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[(1-methylpyrazol-3-yl)amino]-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1-methylpyrazol-3-yl)amino]-1,3-thiazole-5-carboxylate?
The IUPAC name of methyl 2-[(1-methylpyrazol-3-yl)amino]-1,3-thiazole-5-carboxylate (CID 80571956) is methyl 2-[(1-methylpyrazol-3-yl)amino]-1,3-thiazole-5-carboxylate.
What is the SMILES notation for methyl 2-[(1-methylpyrazol-3-yl)amino]-1,3-thiazole-5-carboxylate?
The canonical SMILES for methyl 2-[(1-methylpyrazol-3-yl)amino]-1,3-thiazole-5-carboxylate is COC(=O)c1cnc(Nc2ccn(C)n2)s1.
What is the InChIKey of methyl 2-[(1-methylpyrazol-3-yl)amino]-1,3-thiazole-5-carboxylate?
The InChIKey is DYFQWEKQKJCPLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2S/c1-13-4-3-7(12-13)11-9-10-5-6(16-9)8(14)15-2/h3-5H,1-2H3,(H,10,11,12).
What are the key properties of methyl 2-[(1-methylpyrazol-3-yl)amino]-1,3-thiazole-5-carboxylate?
methyl 2-[(1-methylpyrazol-3-yl)amino]-1,3-thiazole-5-carboxylate has a molecular weight of 238.27 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1-methylpyrazol-3-yl)amino]-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 80571956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).