About methyl (2S)-2-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanoate
methyl (2S)-2-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanoate (PubChem CID 80572159) has the molecular formula C16H22N2O3
and a molecular weight of 290.36 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanoate |
| PubChem CID | 80572159 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | methyl (2S)-2-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)CC1CNc2ccccc21)C(C)C |
| InChI | InChI=1S/C16H22N2O3/c1-10(2)15(16(20)21-3)18-14(19)8-11-9-17-13-7-5-4-6-12(11)13/h4-7,10-11,15,17H,8-9H2,1-3H3,(H,18,19)/t11?,15-/m0/s1 |
| InChIKey | JZBPPXILESXNPK-MHTVFEQDSA-N |
| XLogP | 1.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2S)-2-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanoate?
The IUPAC name of methyl (2S)-2-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanoate (CID 80572159) is methyl (2S)-2-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanoate.
What is the SMILES notation for methyl (2S)-2-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanoate?
The canonical SMILES for methyl (2S)-2-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanoate is COC(=O)[C@@H](NC(=O)CC1CNc2ccccc21)C(C)C.
What is the InChIKey of methyl (2S)-2-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanoate?
The InChIKey is JZBPPXILESXNPK-MHTVFEQDSA-N. The full InChI is InChI=1S/C16H22N2O3/c1-10(2)15(16(20)21-3)18-14(19)8-11-9-17-13-7-5-4-6-12(11)13/h4-7,10-11,15,17H,8-9H2,1-3H3,(H,18,19)/t11?,15-/m0/s1.
What are the key properties of methyl (2S)-2-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanoate?
methyl (2S)-2-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanoate has a molecular weight of 290.36 g/mol, XLogP of 1.90, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanoate is sourced from PubChem (CID 80572159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).