C16H22N2O — CID 80573809
N-cyclohexyl-2-(2,3-dihydro-1H-indol-3-yl)acetamide (PubChem CID 80573809) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is N-cyclohexyl-2-(2,3-dihydro-1H-indol-3-yl)acetamide.
| Compound Name | N-cyclohexyl-2-(2,3-dihydro-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 80573809 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-cyclohexyl-2-(2,3-dihydro-1H-indol-3-yl)acetamide |
| SMILES | O=C(CC1CNc2ccccc21)NC1CCCCC1 |
| InChI | InChI=1S/C16H22N2O/c19-16(18-13-6-2-1-3-7-13)10-12-11-17-15-9-5-4-8-14(12)15/h4-5,8-9,12-13,17H,1-3,6-7,10-11H2,(H,18,19) |
| InChIKey | HAWCJVBRWOODCF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |