About methyl 2-[2-(1-cyclopropylethylamino)-1,3-thiazol-4-yl]acetate
methyl 2-[2-(1-cyclopropylethylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 80574502) has the molecular formula C11H16N2O2S
and a molecular weight of 240.33 g/mol. Its IUPAC name is methyl 2-[2-(1-cyclopropylethylamino)-1,3-thiazol-4-yl]acetate.
Analyze methyl 2-[2-(1-cyclopropylethylamino)-1,3-thiazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-(1-cyclopropylethylamino)-1,3-thiazol-4-yl]acetate?
The IUPAC name of methyl 2-[2-(1-cyclopropylethylamino)-1,3-thiazol-4-yl]acetate (CID 80574502) is methyl 2-[2-(1-cyclopropylethylamino)-1,3-thiazol-4-yl]acetate.
What is the SMILES notation for methyl 2-[2-(1-cyclopropylethylamino)-1,3-thiazol-4-yl]acetate?
The canonical SMILES for methyl 2-[2-(1-cyclopropylethylamino)-1,3-thiazol-4-yl]acetate is COC(=O)Cc1csc(NC(C)C2CC2)n1.
What is the InChIKey of methyl 2-[2-(1-cyclopropylethylamino)-1,3-thiazol-4-yl]acetate?
The InChIKey is XNJRJMXMJZJKLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2S/c1-7(8-3-4-8)12-11-13-9(6-16-11)5-10(14)15-2/h6-8H,3-5H2,1-2H3,(H,12,13).
What are the key properties of methyl 2-[2-(1-cyclopropylethylamino)-1,3-thiazol-4-yl]acetate?
methyl 2-[2-(1-cyclopropylethylamino)-1,3-thiazol-4-yl]acetate has a molecular weight of 240.33 g/mol, XLogP of 2.07, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(1-cyclopropylethylamino)-1,3-thiazol-4-yl]acetate is sourced from PubChem (CID 80574502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).