2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid

C11H16N2O2S — CID 80575363

IUPAC2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid
SMILESCC1CCCCN1c1nc(CC(=O)O)cs1
InChIInChI=1S/C11H16N2O2S/c1-8-4-2-3-5-13(8)11-12-9(7-16-11)6-10(14)15/h7-8H,2-6H2,1H3,(H,14,15)
InChIKeyHMOOHQAQQBXKEF-UHFFFAOYSA-N
MW240.33 g/mol
LogP2.15
Rot. Bonds3

About 2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid

2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 80575363) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid
PubChem CID80575363
Molecular FormulaC11H16N2O2S
Molecular Weight240.33 g/mol
Exact Mass240.09
IUPAC Name2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid
SMILESCC1CCCCN1c1nc(CC(=O)O)cs1
InChIInChI=1S/C11H16N2O2S/c1-8-4-2-3-5-13(8)11-12-9(7-16-11)6-10(14)15/h7-8H,2-6H2,1H3,(H,14,15)
InChIKeyHMOOHQAQQBXKEF-UHFFFAOYSA-N
XLogP2.15
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.33
LogP ≤ 52.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid (CID 80575363) is 2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid is CC1CCCCN1c1nc(CC(=O)O)cs1.
What is the InChIKey of 2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is HMOOHQAQQBXKEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2S/c1-8-4-2-3-5-13(8)11-12-9(7-16-11)6-10(14)15/h7-8H,2-6H2,1H3,(H,14,15).
What are the key properties of 2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid?
2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 240.33 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methylpiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 80575363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).