C14H19N3O2 — CID 80578813
3-[3-(aminomethyl)phenyl]-5-propyl-1,3-diazinane-2,4-dione (PubChem CID 80578813) has the molecular formula C14H19N3O2 and a molecular weight of 261.33 g/mol. Its IUPAC name is 3-[3-(aminomethyl)phenyl]-5-propyl-1,3-diazinane-2,4-dione.
| Compound Name | 3-[3-(aminomethyl)phenyl]-5-propyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 80578813 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-[3-(aminomethyl)phenyl]-5-propyl-1,3-diazinane-2,4-dione |
| SMILES | CCCC1CNC(=O)N(c2cccc(CN)c2)C1=O |
| InChI | InChI=1S/C14H19N3O2/c1-2-4-11-9-16-14(19)17(13(11)18)12-6-3-5-10(7-12)8-15/h3,5-7,11H,2,4,8-9,15H2,1H3,(H,16,19) |
| InChIKey | NUYQPSBBKZXNRR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |