C12H18N2O3 — CID 80579252
(Z)-2-ethyl-4-(2-oxo-3-propylimidazol-1-yl)but-2-enoic acid (PubChem CID 80579252) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is (Z)-2-ethyl-4-(2-oxo-3-propylimidazol-1-yl)but-2-enoic acid.
| Compound Name | (Z)-2-ethyl-4-(2-oxo-3-propylimidazol-1-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 80579252 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | (Z)-2-ethyl-4-(2-oxo-3-propylimidazol-1-yl)but-2-enoic acid |
| SMILES | CCCn1ccn(C/C=C(/CC)C(=O)O)c1=O |
| InChI | InChI=1S/C12H18N2O3/c1-3-6-13-8-9-14(12(13)17)7-5-10(4-2)11(15)16/h5,8-9H,3-4,6-7H2,1-2H3,(H,15,16)/b10-5- |
| InChIKey | GQDFKCUNPULPFO-YHYXMXQVSA-N |
| XLogP | 1.48 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|