About 1-(3,3-diethoxypropyl)-3-ethylimidazol-2-one
1-(3,3-diethoxypropyl)-3-ethylimidazol-2-one (PubChem CID 80580890) has the molecular formula C12H22N2O3
and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-(3,3-diethoxypropyl)-3-ethylimidazol-2-one.
Molecular Properties
| Compound Name | 1-(3,3-diethoxypropyl)-3-ethylimidazol-2-one |
| PubChem CID | 80580890 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 1-(3,3-diethoxypropyl)-3-ethylimidazol-2-one |
| SMILES | CCOC(CCn1ccn(CC)c1=O)OCC |
| InChI | InChI=1S/C12H22N2O3/c1-4-13-9-10-14(12(13)15)8-7-11(16-5-2)17-6-3/h9-11H,4-8H2,1-3H3 |
| InChIKey | QRMSBMSAGCPYHH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 45.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-diethoxypropyl)-3-ethylimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-diethoxypropyl)-3-ethylimidazol-2-one?
The IUPAC name of 1-(3,3-diethoxypropyl)-3-ethylimidazol-2-one (CID 80580890) is 1-(3,3-diethoxypropyl)-3-ethylimidazol-2-one.
What is the SMILES notation for 1-(3,3-diethoxypropyl)-3-ethylimidazol-2-one?
The canonical SMILES for 1-(3,3-diethoxypropyl)-3-ethylimidazol-2-one is CCOC(CCn1ccn(CC)c1=O)OCC.
What is the InChIKey of 1-(3,3-diethoxypropyl)-3-ethylimidazol-2-one?
The InChIKey is QRMSBMSAGCPYHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3/c1-4-13-9-10-14(12(13)15)8-7-11(16-5-2)17-6-3/h9-11H,4-8H2,1-3H3.
What are the key properties of 1-(3,3-diethoxypropyl)-3-ethylimidazol-2-one?
1-(3,3-diethoxypropyl)-3-ethylimidazol-2-one has a molecular weight of 242.32 g/mol, XLogP of 1.46, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-diethoxypropyl)-3-ethylimidazol-2-one is sourced from PubChem (CID 80580890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).