About 1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-methylimidazol-2-one
1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-methylimidazol-2-one (PubChem CID 80581145) has the molecular formula C8H10N4OS
and a molecular weight of 210.26 g/mol. Its IUPAC name is 1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-methylimidazol-2-one.
Molecular Properties
| Compound Name | 1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-methylimidazol-2-one |
| PubChem CID | 80581145 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-methylimidazol-2-one |
| SMILES | Cn1ccn(Cc2csc(N)n2)c1=O |
| InChI | InChI=1S/C8H10N4OS/c1-11-2-3-12(8(11)13)4-6-5-14-7(9)10-6/h2-3,5H,4H2,1H3,(H2,9,10) |
| InChIKey | AWJJARJAOUDGOA-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-methylimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-methylimidazol-2-one?
The IUPAC name of 1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-methylimidazol-2-one (CID 80581145) is 1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-methylimidazol-2-one.
What is the SMILES notation for 1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-methylimidazol-2-one?
The canonical SMILES for 1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-methylimidazol-2-one is Cn1ccn(Cc2csc(N)n2)c1=O.
What is the InChIKey of 1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-methylimidazol-2-one?
The InChIKey is AWJJARJAOUDGOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4OS/c1-11-2-3-12(8(11)13)4-6-5-14-7(9)10-6/h2-3,5H,4H2,1H3,(H2,9,10).
What are the key properties of 1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-methylimidazol-2-one?
1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-methylimidazol-2-one has a molecular weight of 210.26 g/mol, XLogP of 0.27, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-amino-1,3-thiazol-4-yl)methyl]-3-methylimidazol-2-one is sourced from PubChem (CID 80581145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).