C15H16N2O2 — CID 80581515
1-cyclopropyl-3-[2-(3-methylphenyl)-2-oxoethyl]imidazol-2-one (PubChem CID 80581515) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-(3-methylphenyl)-2-oxoethyl]imidazol-2-one.
| Compound Name | 1-cyclopropyl-3-[2-(3-methylphenyl)-2-oxoethyl]imidazol-2-one |
|---|---|
| PubChem CID | 80581515 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-cyclopropyl-3-[2-(3-methylphenyl)-2-oxoethyl]imidazol-2-one |
| SMILES | Cc1cccc(C(=O)Cn2ccn(C3CC3)c2=O)c1 |
| InChI | InChI=1S/C15H16N2O2/c1-11-3-2-4-12(9-11)14(18)10-16-7-8-17(15(16)19)13-5-6-13/h2-4,7-9,13H,5-6,10H2,1H3 |
| InChIKey | GYZVZZDPUSHZNK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |