About 1-propyl-3-[2-(2,2,2-trifluoroethylamino)ethyl]imidazol-2-one
1-propyl-3-[2-(2,2,2-trifluoroethylamino)ethyl]imidazol-2-one (PubChem CID 80582357) has the molecular formula C10H16F3N3O
and a molecular weight of 251.25 g/mol. Its IUPAC name is 1-propyl-3-[2-(2,2,2-trifluoroethylamino)ethyl]imidazol-2-one.
Molecular Properties
| Compound Name | 1-propyl-3-[2-(2,2,2-trifluoroethylamino)ethyl]imidazol-2-one |
| PubChem CID | 80582357 |
| Molecular Formula | C10H16F3N3O |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 1-propyl-3-[2-(2,2,2-trifluoroethylamino)ethyl]imidazol-2-one |
| SMILES | CCCn1ccn(CCNCC(F)(F)F)c1=O |
| InChI | InChI=1S/C10H16F3N3O/c1-2-4-15-6-7-16(9(15)17)5-3-14-8-10(11,12)13/h6-7,14H,2-5,8H2,1H3 |
| InChIKey | OBOWGUNCYDHTNC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 38.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-propyl-3-[2-(2,2,2-trifluoroethylamino)ethyl]imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propyl-3-[2-(2,2,2-trifluoroethylamino)ethyl]imidazol-2-one?
The IUPAC name of 1-propyl-3-[2-(2,2,2-trifluoroethylamino)ethyl]imidazol-2-one (CID 80582357) is 1-propyl-3-[2-(2,2,2-trifluoroethylamino)ethyl]imidazol-2-one.
What is the SMILES notation for 1-propyl-3-[2-(2,2,2-trifluoroethylamino)ethyl]imidazol-2-one?
The canonical SMILES for 1-propyl-3-[2-(2,2,2-trifluoroethylamino)ethyl]imidazol-2-one is CCCn1ccn(CCNCC(F)(F)F)c1=O.
What is the InChIKey of 1-propyl-3-[2-(2,2,2-trifluoroethylamino)ethyl]imidazol-2-one?
The InChIKey is OBOWGUNCYDHTNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3N3O/c1-2-4-15-6-7-16(9(15)17)5-3-14-8-10(11,12)13/h6-7,14H,2-5,8H2,1H3.
What are the key properties of 1-propyl-3-[2-(2,2,2-trifluoroethylamino)ethyl]imidazol-2-one?
1-propyl-3-[2-(2,2,2-trifluoroethylamino)ethyl]imidazol-2-one has a molecular weight of 251.25 g/mol, XLogP of 1.21, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propyl-3-[2-(2,2,2-trifluoroethylamino)ethyl]imidazol-2-one is sourced from PubChem (CID 80582357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).