About 2-azido-5-methyl-[1,2,4]triazolo[1,5-a]pyridine
2-azido-5-methyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 80583618) has the molecular formula C7H6N6
and a molecular weight of 174.17 g/mol. Its IUPAC name is 2-azido-5-methyl-[1,2,4]triazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 2-azido-5-methyl-[1,2,4]triazolo[1,5-a]pyridine |
| PubChem CID | 80583618 |
| Molecular Formula | C7H6N6 |
| Molecular Weight | 174.17 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 2-azido-5-methyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1cccc2nc(N=[N+]=[N-])nn12 |
| InChI | InChI=1S/C7H6N6/c1-5-3-2-4-6-9-7(10-12-8)11-13(5)6/h2-4H,1H3 |
| InChIKey | RUYQLRDOOZPQRV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 78.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.17 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-5-methyl-[1,2,4]triazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-5-methyl-[1,2,4]triazolo[1,5-a]pyridine?
The IUPAC name of 2-azido-5-methyl-[1,2,4]triazolo[1,5-a]pyridine (CID 80583618) is 2-azido-5-methyl-[1,2,4]triazolo[1,5-a]pyridine.
What is the SMILES notation for 2-azido-5-methyl-[1,2,4]triazolo[1,5-a]pyridine?
The canonical SMILES for 2-azido-5-methyl-[1,2,4]triazolo[1,5-a]pyridine is Cc1cccc2nc(N=[N+]=[N-])nn12.
What is the InChIKey of 2-azido-5-methyl-[1,2,4]triazolo[1,5-a]pyridine?
The InChIKey is RUYQLRDOOZPQRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N6/c1-5-3-2-4-6-9-7(10-12-8)11-13(5)6/h2-4H,1H3.
What are the key properties of 2-azido-5-methyl-[1,2,4]triazolo[1,5-a]pyridine?
2-azido-5-methyl-[1,2,4]triazolo[1,5-a]pyridine has a molecular weight of 174.17 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-5-methyl-[1,2,4]triazolo[1,5-a]pyridine is sourced from PubChem (CID 80583618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).