About 2-azido-6-ethoxypyridine
2-azido-6-ethoxypyridine (PubChem CID 80583737) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 2-azido-6-ethoxypyridine.
Molecular Properties
| Compound Name | 2-azido-6-ethoxypyridine |
| PubChem CID | 80583737 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 2-azido-6-ethoxypyridine |
| SMILES | CCOc1cccc(N=[N+]=[N-])n1 |
| InChI | InChI=1S/C7H8N4O/c1-2-12-7-5-3-4-6(9-7)10-11-8/h3-5H,2H2,1H3 |
| InChIKey | OQSMNQAQNXSGSG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-6-ethoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-6-ethoxypyridine?
The IUPAC name of 2-azido-6-ethoxypyridine (CID 80583737) is 2-azido-6-ethoxypyridine.
What is the SMILES notation for 2-azido-6-ethoxypyridine?
The canonical SMILES for 2-azido-6-ethoxypyridine is CCOc1cccc(N=[N+]=[N-])n1.
What is the InChIKey of 2-azido-6-ethoxypyridine?
The InChIKey is OQSMNQAQNXSGSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c1-2-12-7-5-3-4-6(9-7)10-11-8/h3-5H,2H2,1H3.
What are the key properties of 2-azido-6-ethoxypyridine?
2-azido-6-ethoxypyridine has a molecular weight of 164.17 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-6-ethoxypyridine is sourced from PubChem (CID 80583737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).