About (E)-2,3-dichloro-N-(thiolan-2-ylmethyl)prop-2-en-1-amine
(E)-2,3-dichloro-N-(thiolan-2-ylmethyl)prop-2-en-1-amine (PubChem CID 80584471) has the molecular formula C8H13Cl2NS
and a molecular weight of 226.17 g/mol. Its IUPAC name is (E)-2,3-dichloro-N-(thiolan-2-ylmethyl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-2,3-dichloro-N-(thiolan-2-ylmethyl)prop-2-en-1-amine |
| PubChem CID | 80584471 |
| Molecular Formula | C8H13Cl2NS |
| Molecular Weight | 226.17 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | (E)-2,3-dichloro-N-(thiolan-2-ylmethyl)prop-2-en-1-amine |
| SMILES | Cl/C=C(/Cl)CNCC1CCCS1 |
| InChI | InChI=1S/C8H13Cl2NS/c9-4-7(10)5-11-6-8-2-1-3-12-8/h4,8,11H,1-3,5-6H2/b7-4+ |
| InChIKey | LVPWDCRYFHKUIK-QPJJXVBHSA-N |
| XLogP | 2.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.17 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-2,3-dichloro-N-(thiolan-2-ylmethyl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-dichloro-N-(thiolan-2-ylmethyl)prop-2-en-1-amine?
The IUPAC name of (E)-2,3-dichloro-N-(thiolan-2-ylmethyl)prop-2-en-1-amine (CID 80584471) is (E)-2,3-dichloro-N-(thiolan-2-ylmethyl)prop-2-en-1-amine.
What is the SMILES notation for (E)-2,3-dichloro-N-(thiolan-2-ylmethyl)prop-2-en-1-amine?
The canonical SMILES for (E)-2,3-dichloro-N-(thiolan-2-ylmethyl)prop-2-en-1-amine is Cl/C=C(/Cl)CNCC1CCCS1.
What is the InChIKey of (E)-2,3-dichloro-N-(thiolan-2-ylmethyl)prop-2-en-1-amine?
The InChIKey is LVPWDCRYFHKUIK-QPJJXVBHSA-N. The full InChI is InChI=1S/C8H13Cl2NS/c9-4-7(10)5-11-6-8-2-1-3-12-8/h4,8,11H,1-3,5-6H2/b7-4+.
What are the key properties of (E)-2,3-dichloro-N-(thiolan-2-ylmethyl)prop-2-en-1-amine?
(E)-2,3-dichloro-N-(thiolan-2-ylmethyl)prop-2-en-1-amine has a molecular weight of 226.17 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-dichloro-N-(thiolan-2-ylmethyl)prop-2-en-1-amine is sourced from PubChem (CID 80584471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).