C10H18N2O2S — CID 80584597
N-(thiolan-2-ylmethyl)morpholine-2-carboxamide (PubChem CID 80584597) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is N-(thiolan-2-ylmethyl)morpholine-2-carboxamide.
| Compound Name | N-(thiolan-2-ylmethyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 80584597 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | N-(thiolan-2-ylmethyl)morpholine-2-carboxamide |
| SMILES | O=C(NCC1CCCS1)C1CNCCO1 |
| InChI | InChI=1S/C10H18N2O2S/c13-10(9-7-11-3-4-14-9)12-6-8-2-1-5-15-8/h8-9,11H,1-7H2,(H,12,13) |
| InChIKey | WPFGKYWVAHLTAT-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |