C10H16N4O2S2 — CID 80585516
2-hydrazinyl-N-(thiolan-2-ylmethyl)pyridine-3-sulfonamide (PubChem CID 80585516) has the molecular formula C10H16N4O2S2 and a molecular weight of 288.40 g/mol. Its IUPAC name is 2-hydrazinyl-N-(thiolan-2-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | 2-hydrazinyl-N-(thiolan-2-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 80585516 |
| Molecular Formula | C10H16N4O2S2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-hydrazinyl-N-(thiolan-2-ylmethyl)pyridine-3-sulfonamide |
| SMILES | NNc1ncccc1S(=O)(=O)NCC1CCCS1 |
| InChI | InChI=1S/C10H16N4O2S2/c11-14-10-9(4-1-5-12-10)18(15,16)13-7-8-3-2-6-17-8/h1,4-5,8,13H,2-3,6-7,11H2,(H,12,14) |
| InChIKey | HQSXGWRCVVYMRO-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|