About 1-(thiolan-2-ylmethyl)-6,7-dihydro-5H-indol-4-one
1-(thiolan-2-ylmethyl)-6,7-dihydro-5H-indol-4-one (PubChem CID 80586096) has the molecular formula C13H17NOS
and a molecular weight of 235.35 g/mol. Its IUPAC name is 1-(thiolan-2-ylmethyl)-6,7-dihydro-5H-indol-4-one.
Molecular Properties
| Compound Name | 1-(thiolan-2-ylmethyl)-6,7-dihydro-5H-indol-4-one |
| PubChem CID | 80586096 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 1-(thiolan-2-ylmethyl)-6,7-dihydro-5H-indol-4-one |
| SMILES | O=C1CCCc2c1ccn2CC1CCCS1 |
| InChI | InChI=1S/C13H17NOS/c15-13-5-1-4-12-11(13)6-7-14(12)9-10-3-2-8-16-10/h6-7,10H,1-5,8-9H2 |
| InChIKey | KRMUKWJYIUXMRN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(thiolan-2-ylmethyl)-6,7-dihydro-5H-indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(thiolan-2-ylmethyl)-6,7-dihydro-5H-indol-4-one?
The IUPAC name of 1-(thiolan-2-ylmethyl)-6,7-dihydro-5H-indol-4-one (CID 80586096) is 1-(thiolan-2-ylmethyl)-6,7-dihydro-5H-indol-4-one.
What is the SMILES notation for 1-(thiolan-2-ylmethyl)-6,7-dihydro-5H-indol-4-one?
The canonical SMILES for 1-(thiolan-2-ylmethyl)-6,7-dihydro-5H-indol-4-one is O=C1CCCc2c1ccn2CC1CCCS1.
What is the InChIKey of 1-(thiolan-2-ylmethyl)-6,7-dihydro-5H-indol-4-one?
The InChIKey is KRMUKWJYIUXMRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NOS/c15-13-5-1-4-12-11(13)6-7-14(12)9-10-3-2-8-16-10/h6-7,10H,1-5,8-9H2.
What are the key properties of 1-(thiolan-2-ylmethyl)-6,7-dihydro-5H-indol-4-one?
1-(thiolan-2-ylmethyl)-6,7-dihydro-5H-indol-4-one has a molecular weight of 235.35 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(thiolan-2-ylmethyl)-6,7-dihydro-5H-indol-4-one is sourced from PubChem (CID 80586096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).