C13H19NOS — CID 80586158
1-(thiolan-2-ylmethyl)-4,5,6,7-tetrahydroindol-4-ol (PubChem CID 80586158) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 1-(thiolan-2-ylmethyl)-4,5,6,7-tetrahydroindol-4-ol.
| Compound Name | 1-(thiolan-2-ylmethyl)-4,5,6,7-tetrahydroindol-4-ol |
|---|---|
| PubChem CID | 80586158 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-(thiolan-2-ylmethyl)-4,5,6,7-tetrahydroindol-4-ol |
| SMILES | OC1CCCc2c1ccn2CC1CCCS1 |
| InChI | InChI=1S/C13H19NOS/c15-13-5-1-4-12-11(13)6-7-14(12)9-10-3-2-8-16-10/h6-7,10,13,15H,1-5,8-9H2 |
| InChIKey | YPTCLNQPTYORLI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |