About ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]acetate
ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 805875) has the molecular formula C15H15N3O3S2
and a molecular weight of 349.44 g/mol. Its IUPAC name is ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]acetate |
| PubChem CID | 805875 |
| Molecular Formula | C15H15N3O3S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=S)NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C15H15N3O3S2/c1-2-21-12(19)8-11-9-23-15(16-11)18-14(22)17-13(20)10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H2,16,17,18,20,22) |
| InChIKey | NZKFCGVVILYGBE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]acetate?
The IUPAC name of ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]acetate (CID 805875) is ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]acetate.
What is the SMILES notation for ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]acetate?
The canonical SMILES for ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]acetate is CCOC(=O)Cc1csc(NC(=S)NC(=O)c2ccccc2)n1.
What is the InChIKey of ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]acetate?
The InChIKey is NZKFCGVVILYGBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O3S2/c1-2-21-12(19)8-11-9-23-15(16-11)18-14(22)17-13(20)10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H2,16,17,18,20,22).
What are the key properties of ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]acetate?
ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]acetate has a molecular weight of 349.44 g/mol, XLogP of 2.38, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]acetate is sourced from PubChem (CID 805875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).