C14H19N3O2 — CID 80588190
4-[[1-(aminomethyl)-3-methylcyclobutanecarbonyl]amino]benzamide (PubChem CID 80588190) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-[[1-(aminomethyl)-3-methylcyclobutanecarbonyl]amino]benzamide.
| Compound Name | 4-[[1-(aminomethyl)-3-methylcyclobutanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 80588190 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-[[1-(aminomethyl)-3-methylcyclobutanecarbonyl]amino]benzamide |
| SMILES | CC1CC(CN)(C(=O)Nc2ccc(C(N)=O)cc2)C1 |
| InChI | InChI=1S/C14H19N3O2/c1-9-6-14(7-9,8-15)13(19)17-11-4-2-10(3-5-11)12(16)18/h2-5,9H,6-8,15H2,1H3,(H2,16,18)(H,17,19) |
| InChIKey | MMVGFTGMEBTPOV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |