C13H21N3O2S — CID 80588871
1-(1-carbamothioyl-3-methylcyclobutanecarbonyl)piperidine-2-carboxamide (PubChem CID 80588871) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 1-(1-carbamothioyl-3-methylcyclobutanecarbonyl)piperidine-2-carboxamide.
| Compound Name | 1-(1-carbamothioyl-3-methylcyclobutanecarbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 80588871 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 1-(1-carbamothioyl-3-methylcyclobutanecarbonyl)piperidine-2-carboxamide |
| SMILES | CC1CC(C(=O)N2CCCCC2C(N)=O)(C(N)=S)C1 |
| InChI | InChI=1S/C13H21N3O2S/c1-8-6-13(7-8,11(15)19)12(18)16-5-3-2-4-9(16)10(14)17/h8-9H,2-7H2,1H3,(H2,14,17)(H2,15,19) |
| InChIKey | WMEKCDKNGLHOMP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|