About 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclopropane-1-carbothioamide
1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclopropane-1-carbothioamide (PubChem CID 80588907) has the molecular formula C11H16F3N3OS
and a molecular weight of 295.33 g/mol. Its IUPAC name is 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclopropane-1-carbothioamide.
Molecular Properties
| Compound Name | 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclopropane-1-carbothioamide |
| PubChem CID | 80588907 |
| Molecular Formula | C11H16F3N3OS |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclopropane-1-carbothioamide |
| SMILES | NC(=S)C1(C(=O)N2CCN(CC(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C11H16F3N3OS/c12-11(13,14)7-16-3-5-17(6-4-16)9(18)10(1-2-10)8(15)19/h1-7H2,(H2,15,19) |
| InChIKey | ITHAJDTZNWXYFM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclopropane-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclopropane-1-carbothioamide?
The IUPAC name of 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclopropane-1-carbothioamide (CID 80588907) is 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclopropane-1-carbothioamide.
What is the SMILES notation for 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclopropane-1-carbothioamide?
The canonical SMILES for 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclopropane-1-carbothioamide is NC(=S)C1(C(=O)N2CCN(CC(F)(F)F)CC2)CC1.
What is the InChIKey of 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclopropane-1-carbothioamide?
The InChIKey is ITHAJDTZNWXYFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N3OS/c12-11(13,14)7-16-3-5-17(6-4-16)9(18)10(1-2-10)8(15)19/h1-7H2,(H2,15,19).
What are the key properties of 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclopropane-1-carbothioamide?
1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclopropane-1-carbothioamide has a molecular weight of 295.33 g/mol, XLogP of 0.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclopropane-1-carbothioamide is sourced from PubChem (CID 80588907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).