C11H12BrN3OS — CID 80590582
N-(5-bromo-4-methyl-2-pyridinyl)-1-carbamothioylcyclopropane-1-carboxamide (PubChem CID 80590582) has the molecular formula C11H12BrN3OS and a molecular weight of 314.21 g/mol. Its IUPAC name is N-(5-bromo-4-methyl-2-pyridinyl)-1-carbamothioylcyclopropane-1-carboxamide.
| Compound Name | N-(5-bromo-4-methyl-2-pyridinyl)-1-carbamothioylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 80590582 |
| Molecular Formula | C11H12BrN3OS |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | N-(5-bromo-4-methyl-2-pyridinyl)-1-carbamothioylcyclopropane-1-carboxamide |
| SMILES | Cc1cc(NC(=O)C2(C(N)=S)CC2)ncc1Br |
| InChI | InChI=1S/C11H12BrN3OS/c1-6-4-8(14-5-7(6)12)15-10(16)11(2-3-11)9(13)17/h4-5H,2-3H2,1H3,(H2,13,17)(H,14,15,16) |
| InChIKey | GRNCICXKNSTSEC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|