C15H29N3O2 — CID 80593590
N-decyl-1-(N'-hydroxycarbamimidoyl)cyclopropane-1-carboxamide (PubChem CID 80593590) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is N-decyl-1-(N'-hydroxycarbamimidoyl)cyclopropane-1-carboxamide.
| Compound Name | N-decyl-1-(N'-hydroxycarbamimidoyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 80593590 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | N-decyl-1-(N'-hydroxycarbamimidoyl)cyclopropane-1-carboxamide |
| SMILES | CCCCCCCCCCNC(=O)C1(C(N)=NO)CC1 |
| InChI | InChI=1S/C15H29N3O2/c1-2-3-4-5-6-7-8-9-12-17-14(19)15(10-11-15)13(16)18-20/h20H,2-12H2,1H3,(H2,16,18)(H,17,19) |
| InChIKey | UDSKLRIMXWOYGM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|