C11H17NO4S — CID 80593854
(2S)-4-hydroxy-1-(thiane-2-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 80593854) has the molecular formula C11H17NO4S and a molecular weight of 259.33 g/mol. Its IUPAC name is (2S)-4-hydroxy-1-(thiane-2-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-4-hydroxy-1-(thiane-2-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 80593854 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | (2S)-4-hydroxy-1-(thiane-2-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC(O)CN1C(=O)C1CCCCS1 |
| InChI | InChI=1S/C11H17NO4S/c13-7-5-8(11(15)16)12(6-7)10(14)9-3-1-2-4-17-9/h7-9,13H,1-6H2,(H,15,16)/t7?,8-,9?/m0/s1 |
| InChIKey | RBHMXLZRCFQNEV-MGURRDGZSA-N |
| XLogP | 0.32 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |