C11H14BrN3O2S — CID 80594461
N-[(5-bromothiophen-2-yl)methyl]-1-[(E)-N'-hydroxycarbamimidoyl]cyclobutane-1-carboxamide (PubChem CID 80594461) has the molecular formula C11H14BrN3O2S and a molecular weight of 332.22 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-1-[(E)-N'-hydroxycarbamimidoyl]cyclobutane-1-carboxamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-1-[(E)-N'-hydroxycarbamimidoyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 80594461 |
| Molecular Formula | C11H14BrN3O2S |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-1-[(E)-N'-hydroxycarbamimidoyl]cyclobutane-1-carboxamide |
| SMILES | N/C(=N/O)C1(C(=O)NCc2ccc(Br)s2)CCC1 |
| InChI | InChI=1S/C11H14BrN3O2S/c12-8-3-2-7(18-8)6-14-10(16)11(4-1-5-11)9(13)15-17/h2-3,17H,1,4-6H2,(H2,13,15)(H,14,16) |
| InChIKey | UHMBFVONYMVAGL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|