About N-(2,6-dioxopiperidin-3-yl)-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide
N-(2,6-dioxopiperidin-3-yl)-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide (PubChem CID 80594472) has the molecular formula C12H18N4O4
and a molecular weight of 282.30 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide |
| PubChem CID | 80594472 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide |
| SMILES | CC1CC(C(=O)NC2CCC(=O)NC2=O)(C(N)=NO)C1 |
| InChI | InChI=1S/C12H18N4O4/c1-6-4-12(5-6,10(13)16-20)11(19)14-7-2-3-8(17)15-9(7)18/h6-7,20H,2-5H2,1H3,(H2,13,16)(H,14,19)(H,15,17,18) |
| InChIKey | WZHCCXIRHPGMDN-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-dioxopiperidin-3-yl)-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dioxopiperidin-3-yl)-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide?
The IUPAC name of N-(2,6-dioxopiperidin-3-yl)-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide (CID 80594472) is N-(2,6-dioxopiperidin-3-yl)-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide.
What is the SMILES notation for N-(2,6-dioxopiperidin-3-yl)-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide?
The canonical SMILES for N-(2,6-dioxopiperidin-3-yl)-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide is CC1CC(C(=O)NC2CCC(=O)NC2=O)(C(N)=NO)C1.
What is the InChIKey of N-(2,6-dioxopiperidin-3-yl)-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide?
The InChIKey is WZHCCXIRHPGMDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O4/c1-6-4-12(5-6,10(13)16-20)11(19)14-7-2-3-8(17)15-9(7)18/h6-7,20H,2-5H2,1H3,(H2,13,16)(H,14,19)(H,15,17,18).
What are the key properties of N-(2,6-dioxopiperidin-3-yl)-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide?
N-(2,6-dioxopiperidin-3-yl)-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide has a molecular weight of 282.30 g/mol, XLogP of -0.93, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dioxopiperidin-3-yl)-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide is sourced from PubChem (CID 80594472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).