C12H18N4O4 — CID 80594473
1-(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)-N'-hydroxycyclobutane-1-carboximidamide (PubChem CID 80594473) has the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 1-(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)-N'-hydroxycyclobutane-1-carboximidamide.
| Compound Name | 1-(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)-N'-hydroxycyclobutane-1-carboximidamide |
|---|---|
| PubChem CID | 80594473 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 1-(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)-N'-hydroxycyclobutane-1-carboximidamide |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)C1(C(N)=NO)CCC1 |
| InChI | InChI=1S/C12H18N4O4/c1-11(2)9(18)14-7(17)6-16(11)10(19)12(4-3-5-12)8(13)15-20/h20H,3-6H2,1-2H3,(H2,13,15)(H,14,17,18) |
| InChIKey | ACCFZXRXLINADI-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|