C10H11ClN4S — CID 80595030
6-chloro-3-(thian-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 80595030) has the molecular formula C10H11ClN4S and a molecular weight of 254.75 g/mol. Its IUPAC name is 6-chloro-3-(thian-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-chloro-3-(thian-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 80595030 |
| Molecular Formula | C10H11ClN4S |
| Molecular Weight | 254.75 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 6-chloro-3-(thian-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | Clc1ccc2nnc(C3CCCCS3)n2n1 |
| InChI | InChI=1S/C10H11ClN4S/c11-8-4-5-9-12-13-10(15(9)14-8)7-3-1-2-6-16-7/h4-5,7H,1-3,6H2 |
| InChIKey | SMQBHAABJJQKCO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.75 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |