C15H23NO2S2 — CID 80595105
1-(4-methylsulfonylphenyl)-N-(thian-2-ylmethyl)ethanamine (PubChem CID 80595105) has the molecular formula C15H23NO2S2 and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-(4-methylsulfonylphenyl)-N-(thian-2-ylmethyl)ethanamine.
| Compound Name | 1-(4-methylsulfonylphenyl)-N-(thian-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 80595105 |
| Molecular Formula | C15H23NO2S2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 1-(4-methylsulfonylphenyl)-N-(thian-2-ylmethyl)ethanamine |
| SMILES | CC(NCC1CCCCS1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H23NO2S2/c1-12(16-11-14-5-3-4-10-19-14)13-6-8-15(9-7-13)20(2,17)18/h6-9,12,14,16H,3-5,10-11H2,1-2H3 |
| InChIKey | QHXNSTQZRKKTKS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |