About 2-[5-(thian-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine
2-[5-(thian-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine (PubChem CID 80596034) has the molecular formula C9H15N3S2
and a molecular weight of 229.37 g/mol. Its IUPAC name is 2-[5-(thian-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[5-(thian-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine |
| PubChem CID | 80596034 |
| Molecular Formula | C9H15N3S2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-[5-(thian-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine |
| SMILES | NCCc1nnc(C2CCCCS2)s1 |
| InChI | InChI=1S/C9H15N3S2/c10-5-4-8-11-12-9(14-8)7-3-1-2-6-13-7/h7H,1-6,10H2 |
| InChIKey | LGWPTYZBPIVRSZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-(thian-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(thian-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine?
The IUPAC name of 2-[5-(thian-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine (CID 80596034) is 2-[5-(thian-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine.
What is the SMILES notation for 2-[5-(thian-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine?
The canonical SMILES for 2-[5-(thian-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine is NCCc1nnc(C2CCCCS2)s1.
What is the InChIKey of 2-[5-(thian-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine?
The InChIKey is LGWPTYZBPIVRSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3S2/c10-5-4-8-11-12-9(14-8)7-3-1-2-6-13-7/h7H,1-6,10H2.
What are the key properties of 2-[5-(thian-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine?
2-[5-(thian-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine has a molecular weight of 229.37 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(thian-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine is sourced from PubChem (CID 80596034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).