About 4-N-(thian-2-ylmethyl)quinazoline-4,7-diamine
4-N-(thian-2-ylmethyl)quinazoline-4,7-diamine (PubChem CID 80596359) has the molecular formula C14H18N4S
and a molecular weight of 274.39 g/mol. Its IUPAC name is 4-N-(thian-2-ylmethyl)quinazoline-4,7-diamine.
Molecular Properties
| Compound Name | 4-N-(thian-2-ylmethyl)quinazoline-4,7-diamine |
| PubChem CID | 80596359 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-N-(thian-2-ylmethyl)quinazoline-4,7-diamine |
| SMILES | Nc1ccc2c(NCC3CCCCS3)ncnc2c1 |
| InChI | InChI=1S/C14H18N4S/c15-10-4-5-12-13(7-10)17-9-18-14(12)16-8-11-3-1-2-6-19-11/h4-5,7,9,11H,1-3,6,8,15H2,(H,16,17,18) |
| InChIKey | SZJCZXLYQOBRDJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(thian-2-ylmethyl)quinazoline-4,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(thian-2-ylmethyl)quinazoline-4,7-diamine?
The IUPAC name of 4-N-(thian-2-ylmethyl)quinazoline-4,7-diamine (CID 80596359) is 4-N-(thian-2-ylmethyl)quinazoline-4,7-diamine.
What is the SMILES notation for 4-N-(thian-2-ylmethyl)quinazoline-4,7-diamine?
The canonical SMILES for 4-N-(thian-2-ylmethyl)quinazoline-4,7-diamine is Nc1ccc2c(NCC3CCCCS3)ncnc2c1.
What is the InChIKey of 4-N-(thian-2-ylmethyl)quinazoline-4,7-diamine?
The InChIKey is SZJCZXLYQOBRDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4S/c15-10-4-5-12-13(7-10)17-9-18-14(12)16-8-11-3-1-2-6-19-11/h4-5,7,9,11H,1-3,6,8,15H2,(H,16,17,18).
What are the key properties of 4-N-(thian-2-ylmethyl)quinazoline-4,7-diamine?
4-N-(thian-2-ylmethyl)quinazoline-4,7-diamine has a molecular weight of 274.39 g/mol, XLogP of 2.91, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(thian-2-ylmethyl)quinazoline-4,7-diamine is sourced from PubChem (CID 80596359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).