About N-phenyl-1,3-benzothiazole-2-carbothioamide
N-phenyl-1,3-benzothiazole-2-carbothioamide (PubChem CID 805979) has the molecular formula C14H10N2S2
and a molecular weight of 270.38 g/mol. Its IUPAC name is N-phenyl-1,3-benzothiazole-2-carbothioamide.
Molecular Properties
| Compound Name | N-phenyl-1,3-benzothiazole-2-carbothioamide |
| PubChem CID | 805979 |
| Molecular Formula | C14H10N2S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | N-phenyl-1,3-benzothiazole-2-carbothioamide |
| SMILES | S=C(Nc1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H10N2S2/c17-13(15-10-6-2-1-3-7-10)14-16-11-8-4-5-9-12(11)18-14/h1-9H,(H,15,17) |
| InChIKey | ISLUDHJMZMYMFS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-phenyl-1,3-benzothiazole-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-1,3-benzothiazole-2-carbothioamide?
The IUPAC name of N-phenyl-1,3-benzothiazole-2-carbothioamide (CID 805979) is N-phenyl-1,3-benzothiazole-2-carbothioamide.
What is the SMILES notation for N-phenyl-1,3-benzothiazole-2-carbothioamide?
The canonical SMILES for N-phenyl-1,3-benzothiazole-2-carbothioamide is S=C(Nc1ccccc1)c1nc2ccccc2s1.
What is the InChIKey of N-phenyl-1,3-benzothiazole-2-carbothioamide?
The InChIKey is ISLUDHJMZMYMFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2S2/c17-13(15-10-6-2-1-3-7-10)14-16-11-8-4-5-9-12(11)18-14/h1-9H,(H,15,17).
What are the key properties of N-phenyl-1,3-benzothiazole-2-carbothioamide?
N-phenyl-1,3-benzothiazole-2-carbothioamide has a molecular weight of 270.38 g/mol, XLogP of 4.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-1,3-benzothiazole-2-carbothioamide is sourced from PubChem (CID 805979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).