About 1-(aminomethyl)-N-(2,2-dimethylcyclohexyl)cyclopropane-1-carboxamide
1-(aminomethyl)-N-(2,2-dimethylcyclohexyl)cyclopropane-1-carboxamide (PubChem CID 80598202) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-(aminomethyl)-N-(2,2-dimethylcyclohexyl)cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | 1-(aminomethyl)-N-(2,2-dimethylcyclohexyl)cyclopropane-1-carboxamide |
| PubChem CID | 80598202 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 1-(aminomethyl)-N-(2,2-dimethylcyclohexyl)cyclopropane-1-carboxamide |
| SMILES | CC1(C)CCCCC1NC(=O)C1(CN)CC1 |
| InChI | InChI=1S/C13H24N2O/c1-12(2)6-4-3-5-10(12)15-11(16)13(9-14)7-8-13/h10H,3-9,14H2,1-2H3,(H,15,16) |
| InChIKey | JMKFHUBUTPOSCF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(aminomethyl)-N-(2,2-dimethylcyclohexyl)cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(aminomethyl)-N-(2,2-dimethylcyclohexyl)cyclopropane-1-carboxamide?
The IUPAC name of 1-(aminomethyl)-N-(2,2-dimethylcyclohexyl)cyclopropane-1-carboxamide (CID 80598202) is 1-(aminomethyl)-N-(2,2-dimethylcyclohexyl)cyclopropane-1-carboxamide.
What is the SMILES notation for 1-(aminomethyl)-N-(2,2-dimethylcyclohexyl)cyclopropane-1-carboxamide?
The canonical SMILES for 1-(aminomethyl)-N-(2,2-dimethylcyclohexyl)cyclopropane-1-carboxamide is CC1(C)CCCCC1NC(=O)C1(CN)CC1.
What is the InChIKey of 1-(aminomethyl)-N-(2,2-dimethylcyclohexyl)cyclopropane-1-carboxamide?
The InChIKey is JMKFHUBUTPOSCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O/c1-12(2)6-4-3-5-10(12)15-11(16)13(9-14)7-8-13/h10H,3-9,14H2,1-2H3,(H,15,16).
What are the key properties of 1-(aminomethyl)-N-(2,2-dimethylcyclohexyl)cyclopropane-1-carboxamide?
1-(aminomethyl)-N-(2,2-dimethylcyclohexyl)cyclopropane-1-carboxamide has a molecular weight of 224.35 g/mol, XLogP of 1.81, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(aminomethyl)-N-(2,2-dimethylcyclohexyl)cyclopropane-1-carboxamide is sourced from PubChem (CID 80598202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).