About 1-cyano-N,N-diethylcyclopropane-1-carboxamide
1-cyano-N,N-diethylcyclopropane-1-carboxamide (PubChem CID 80598322) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-cyano-N,N-diethylcyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | 1-cyano-N,N-diethylcyclopropane-1-carboxamide |
| PubChem CID | 80598322 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1-cyano-N,N-diethylcyclopropane-1-carboxamide |
| SMILES | CCN(CC)C(=O)C1(C#N)CC1 |
| InChI | InChI=1S/C9H14N2O/c1-3-11(4-2)8(12)9(7-10)5-6-9/h3-6H2,1-2H3 |
| InChIKey | FPNVCPCAWYHKTJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyano-N,N-diethylcyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-N,N-diethylcyclopropane-1-carboxamide?
The IUPAC name of 1-cyano-N,N-diethylcyclopropane-1-carboxamide (CID 80598322) is 1-cyano-N,N-diethylcyclopropane-1-carboxamide.
What is the SMILES notation for 1-cyano-N,N-diethylcyclopropane-1-carboxamide?
The canonical SMILES for 1-cyano-N,N-diethylcyclopropane-1-carboxamide is CCN(CC)C(=O)C1(C#N)CC1.
What is the InChIKey of 1-cyano-N,N-diethylcyclopropane-1-carboxamide?
The InChIKey is FPNVCPCAWYHKTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-3-11(4-2)8(12)9(7-10)5-6-9/h3-6H2,1-2H3.
What are the key properties of 1-cyano-N,N-diethylcyclopropane-1-carboxamide?
1-cyano-N,N-diethylcyclopropane-1-carboxamide has a molecular weight of 166.22 g/mol, XLogP of 1.16, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-N,N-diethylcyclopropane-1-carboxamide is sourced from PubChem (CID 80598322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).