C14H22N4O3 — CID 80598910
N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide (PubChem CID 80598910) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide.
| Compound Name | N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 80598910 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-1-(N'-hydroxycarbamimidoyl)-3-methylcyclobutane-1-carboxamide |
| SMILES | Cc1noc(C)c1C(C)NC(=O)C1(C(N)=NO)CC(C)C1 |
| InChI | InChI=1S/C14H22N4O3/c1-7-5-14(6-7,12(15)17-20)13(19)16-8(2)11-9(3)18-21-10(11)4/h7-8,20H,5-6H2,1-4H3,(H2,15,17)(H,16,19) |
| InChIKey | IAQAOZDRTFLMRT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|