C11H20N2S — CID 80599802
N-(thian-2-ylmethyl)-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 80599802) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is N-(thian-2-ylmethyl)-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | N-(thian-2-ylmethyl)-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 80599802 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N-(thian-2-ylmethyl)-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | C1CCC(NCC2CCCCS2)=NC1 |
| InChI | InChI=1S/C11H20N2S/c1-3-7-12-11(6-1)13-9-10-5-2-4-8-14-10/h10H,1-9H2,(H,12,13) |
| InChIKey | RKMITVRWJAZULN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |