C10H13NO2S — CID 80599937
1-(thian-2-ylmethyl)pyrrole-2,5-dione (PubChem CID 80599937) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 1-(thian-2-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 1-(thian-2-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 80599937 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 1-(thian-2-ylmethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CC1CCCCS1 |
| InChI | InChI=1S/C10H13NO2S/c12-9-4-5-10(13)11(9)7-8-3-1-2-6-14-8/h4-5,8H,1-3,6-7H2 |
| InChIKey | WHHBNEITJHYYKQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|