C15H21NO2S — CID 80599965
methyl 2-[(thian-2-ylmethylamino)methyl]benzoate (PubChem CID 80599965) has the molecular formula C15H21NO2S and a molecular weight of 279.40 g/mol. Its IUPAC name is methyl 2-[(thian-2-ylmethylamino)methyl]benzoate.
| Compound Name | methyl 2-[(thian-2-ylmethylamino)methyl]benzoate |
|---|---|
| PubChem CID | 80599965 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | methyl 2-[(thian-2-ylmethylamino)methyl]benzoate |
| SMILES | COC(=O)c1ccccc1CNCC1CCCCS1 |
| InChI | InChI=1S/C15H21NO2S/c1-18-15(17)14-8-3-2-6-12(14)10-16-11-13-7-4-5-9-19-13/h2-3,6,8,13,16H,4-5,7,9-11H2,1H3 |
| InChIKey | AILKPFJEJFAYOM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |