C16H23NS — CID 80600159
N-(thian-2-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 80600159) has the molecular formula C16H23NS and a molecular weight of 261.43 g/mol. Its IUPAC name is N-(thian-2-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | N-(thian-2-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 80600159 |
| Molecular Formula | C16H23NS |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | N-(thian-2-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | c1ccc2c(c1)CCC(NCC1CCCCS1)C2 |
| InChI | InChI=1S/C16H23NS/c1-2-6-14-11-15(9-8-13(14)5-1)17-12-16-7-3-4-10-18-16/h1-2,5-6,15-17H,3-4,7-12H2 |
| InChIKey | QGRZFIOOAMMRJJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |