C14H18Cl2N2OS — CID 80600328
N-(2,6-dichlorophenyl)-2-(thian-2-ylmethylamino)acetamide (PubChem CID 80600328) has the molecular formula C14H18Cl2N2OS and a molecular weight of 333.28 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-(thian-2-ylmethylamino)acetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-(thian-2-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 80600328 |
| Molecular Formula | C14H18Cl2N2OS |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-(thian-2-ylmethylamino)acetamide |
| SMILES | O=C(CNCC1CCCCS1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H18Cl2N2OS/c15-11-5-3-6-12(16)14(11)18-13(19)9-17-8-10-4-1-2-7-20-10/h3,5-6,10,17H,1-2,4,7-9H2,(H,18,19) |
| InChIKey | JIPYXDVUYUBLKN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |