About N-(thian-2-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine
N-(thian-2-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 80601114) has the molecular formula C10H18N2S
and a molecular weight of 198.33 g/mol. Its IUPAC name is N-(thian-2-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine.
Molecular Properties
| Compound Name | N-(thian-2-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine |
| PubChem CID | 80601114 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | N-(thian-2-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | C1CCC(CNC2=NCCC2)SC1 |
| InChI | InChI=1S/C10H18N2S/c1-2-7-13-9(4-1)8-12-10-5-3-6-11-10/h9H,1-8H2,(H,11,12) |
| InChIKey | ZCQRZJSOMCUQLU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(thian-2-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(thian-2-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine?
The IUPAC name of N-(thian-2-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine (CID 80601114) is N-(thian-2-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine.
What is the SMILES notation for N-(thian-2-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine?
The canonical SMILES for N-(thian-2-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine is C1CCC(CNC2=NCCC2)SC1.
What is the InChIKey of N-(thian-2-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine?
The InChIKey is ZCQRZJSOMCUQLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S/c1-2-7-13-9(4-1)8-12-10-5-3-6-11-10/h9H,1-8H2,(H,11,12).
What are the key properties of N-(thian-2-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine?
N-(thian-2-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine has a molecular weight of 198.33 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(thian-2-ylmethyl)-3,4-dihydro-2H-pyrrol-5-amine is sourced from PubChem (CID 80601114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).