C18H28O2 — CID 80603730
1-cyclooctyl-3-(4-methoxyphenyl)propan-1-ol (PubChem CID 80603730) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-cyclooctyl-3-(4-methoxyphenyl)propan-1-ol.
| Compound Name | 1-cyclooctyl-3-(4-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 80603730 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 1-cyclooctyl-3-(4-methoxyphenyl)propan-1-ol |
| SMILES | COc1ccc(CCC(O)C2CCCCCCC2)cc1 |
| InChI | InChI=1S/C18H28O2/c1-20-17-12-9-15(10-13-17)11-14-18(19)16-7-5-3-2-4-6-8-16/h9-10,12-13,16,18-19H,2-8,11,14H2,1H3 |
| InChIKey | OUMJTXGCEHYGGJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |