About 3-(difluoromethyl)-N-methyl-1,1-dioxothiolan-3-amine
3-(difluoromethyl)-N-methyl-1,1-dioxothiolan-3-amine (PubChem CID 80604198) has the molecular formula C6H11F2NO2S
and a molecular weight of 199.22 g/mol. Its IUPAC name is 3-(difluoromethyl)-N-methyl-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-N-methyl-1,1-dioxothiolan-3-amine |
| PubChem CID | 80604198 |
| Molecular Formula | C6H11F2NO2S |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 3-(difluoromethyl)-N-methyl-1,1-dioxothiolan-3-amine |
| SMILES | CNC1(C(F)F)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H11F2NO2S/c1-9-6(5(7)8)2-3-12(10,11)4-6/h5,9H,2-4H2,1H3 |
| InChIKey | VCVOWTIQWIXCBZ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(difluoromethyl)-N-methyl-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-N-methyl-1,1-dioxothiolan-3-amine?
The IUPAC name of 3-(difluoromethyl)-N-methyl-1,1-dioxothiolan-3-amine (CID 80604198) is 3-(difluoromethyl)-N-methyl-1,1-dioxothiolan-3-amine.
What is the SMILES notation for 3-(difluoromethyl)-N-methyl-1,1-dioxothiolan-3-amine?
The canonical SMILES for 3-(difluoromethyl)-N-methyl-1,1-dioxothiolan-3-amine is CNC1(C(F)F)CCS(=O)(=O)C1.
What is the InChIKey of 3-(difluoromethyl)-N-methyl-1,1-dioxothiolan-3-amine?
The InChIKey is VCVOWTIQWIXCBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2NO2S/c1-9-6(5(7)8)2-3-12(10,11)4-6/h5,9H,2-4H2,1H3.
What are the key properties of 3-(difluoromethyl)-N-methyl-1,1-dioxothiolan-3-amine?
3-(difluoromethyl)-N-methyl-1,1-dioxothiolan-3-amine has a molecular weight of 199.22 g/mol, XLogP of 0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-N-methyl-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 80604198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).