About 4-(difluoromethyl)-1,1-dioxothian-4-amine
4-(difluoromethyl)-1,1-dioxothian-4-amine (PubChem CID 80604427) has the molecular formula C6H11F2NO2S
and a molecular weight of 199.22 g/mol. Its IUPAC name is 4-(difluoromethyl)-1,1-dioxothian-4-amine.
Molecular Properties
| Compound Name | 4-(difluoromethyl)-1,1-dioxothian-4-amine |
| PubChem CID | 80604427 |
| Molecular Formula | C6H11F2NO2S |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 4-(difluoromethyl)-1,1-dioxothian-4-amine |
| SMILES | NC1(C(F)F)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C6H11F2NO2S/c7-5(8)6(9)1-3-12(10,11)4-2-6/h5H,1-4,9H2 |
| InChIKey | KBSZNPFYQATBNX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(difluoromethyl)-1,1-dioxothian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-1,1-dioxothian-4-amine?
The IUPAC name of 4-(difluoromethyl)-1,1-dioxothian-4-amine (CID 80604427) is 4-(difluoromethyl)-1,1-dioxothian-4-amine.
What is the SMILES notation for 4-(difluoromethyl)-1,1-dioxothian-4-amine?
The canonical SMILES for 4-(difluoromethyl)-1,1-dioxothian-4-amine is NC1(C(F)F)CCS(=O)(=O)CC1.
What is the InChIKey of 4-(difluoromethyl)-1,1-dioxothian-4-amine?
The InChIKey is KBSZNPFYQATBNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2NO2S/c7-5(8)6(9)1-3-12(10,11)4-2-6/h5H,1-4,9H2.
What are the key properties of 4-(difluoromethyl)-1,1-dioxothian-4-amine?
4-(difluoromethyl)-1,1-dioxothian-4-amine has a molecular weight of 199.22 g/mol, XLogP of 0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-1,1-dioxothian-4-amine is sourced from PubChem (CID 80604427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).