C11H14F3N — CID 80604450
N-ethyl-1,1-difluoro-2-(3-fluorophenyl)propan-2-amine (PubChem CID 80604450) has the molecular formula C11H14F3N and a molecular weight of 217.23 g/mol. Its IUPAC name is N-ethyl-1,1-difluoro-2-(3-fluorophenyl)propan-2-amine.
| Compound Name | N-ethyl-1,1-difluoro-2-(3-fluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 80604450 |
| Molecular Formula | C11H14F3N |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-ethyl-1,1-difluoro-2-(3-fluorophenyl)propan-2-amine |
| SMILES | CCNC(C)(c1cccc(F)c1)C(F)F |
| InChI | InChI=1S/C11H14F3N/c1-3-15-11(2,10(13)14)8-5-4-6-9(12)7-8/h4-7,10,15H,3H2,1-2H3 |
| InChIKey | IXVPIDOHLZDDHC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |