About N-ethyl-1,1-difluoro-4-methoxy-2,4-dimethylpentan-2-amine
N-ethyl-1,1-difluoro-4-methoxy-2,4-dimethylpentan-2-amine (PubChem CID 80604812) has the molecular formula C10H21F2NO
and a molecular weight of 209.28 g/mol. Its IUPAC name is N-ethyl-1,1-difluoro-4-methoxy-2,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | N-ethyl-1,1-difluoro-4-methoxy-2,4-dimethylpentan-2-amine |
| PubChem CID | 80604812 |
| Molecular Formula | C10H21F2NO |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | N-ethyl-1,1-difluoro-4-methoxy-2,4-dimethylpentan-2-amine |
| SMILES | CCNC(C)(CC(C)(C)OC)C(F)F |
| InChI | InChI=1S/C10H21F2NO/c1-6-13-10(4,8(11)12)7-9(2,3)14-5/h8,13H,6-7H2,1-5H3 |
| InChIKey | AOKJBJUZKBGFIK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-1,1-difluoro-4-methoxy-2,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1,1-difluoro-4-methoxy-2,4-dimethylpentan-2-amine?
The IUPAC name of N-ethyl-1,1-difluoro-4-methoxy-2,4-dimethylpentan-2-amine (CID 80604812) is N-ethyl-1,1-difluoro-4-methoxy-2,4-dimethylpentan-2-amine.
What is the SMILES notation for N-ethyl-1,1-difluoro-4-methoxy-2,4-dimethylpentan-2-amine?
The canonical SMILES for N-ethyl-1,1-difluoro-4-methoxy-2,4-dimethylpentan-2-amine is CCNC(C)(CC(C)(C)OC)C(F)F.
What is the InChIKey of N-ethyl-1,1-difluoro-4-methoxy-2,4-dimethylpentan-2-amine?
The InChIKey is AOKJBJUZKBGFIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F2NO/c1-6-13-10(4,8(11)12)7-9(2,3)14-5/h8,13H,6-7H2,1-5H3.
What are the key properties of N-ethyl-1,1-difluoro-4-methoxy-2,4-dimethylpentan-2-amine?
N-ethyl-1,1-difluoro-4-methoxy-2,4-dimethylpentan-2-amine has a molecular weight of 209.28 g/mol, XLogP of 2.43, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1,1-difluoro-4-methoxy-2,4-dimethylpentan-2-amine is sourced from PubChem (CID 80604812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).